About (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride
(R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride (PubChem CID 155973718) has the molecular formula C12H23Cl2N3
and a molecular weight of 280.24 g/mol. Its IUPAC name is (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride |
| PubChem CID | 155973718 |
| Molecular Formula | C12H23Cl2N3 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride |
| SMILES | Cc1cn(C)nc1[C@H](N)C1(C)CCCC1.Cl.Cl |
| InChI | InChI=1S/C12H21N3.2ClH/c1-9-8-15(3)14-10(9)11(13)12(2)6-4-5-7-12;;/h8,11H,4-7,13H2,1-3H3;2*1H/t11-;;/m0../s1 |
| InChIKey | QNKBGBOKCBFEKE-IDMXKUIJSA-N |
| XLogP | 3.15 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride?
The IUPAC name of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride (CID 155973718) is (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride.
What is the SMILES notation for (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride?
The canonical SMILES for (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride is Cc1cn(C)nc1[C@H](N)C1(C)CCCC1.Cl.Cl.
What is the InChIKey of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride?
The InChIKey is QNKBGBOKCBFEKE-IDMXKUIJSA-N. The full InChI is InChI=1S/C12H21N3.2ClH/c1-9-8-15(3)14-10(9)11(13)12(2)6-4-5-7-12;;/h8,11H,4-7,13H2,1-3H3;2*1H/t11-;;/m0../s1.
What are the key properties of (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride?
(R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride has a molecular weight of 280.24 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-(1,4-dimethylpyrazol-3-yl)-(1-methylcyclopentyl)methanamine;dihydrochloride is sourced from PubChem (CID 155973718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).