C7H10IN3 — CID 155973791
3-iodo-4,5,6,7-tetrahydro-1H-indazol-7-amine (PubChem CID 155973791) has the molecular formula C7H10IN3 and a molecular weight of 263.08 g/mol. Its IUPAC name is 3-iodo-4,5,6,7-tetrahydro-1H-indazol-7-amine.
| Compound Name | 3-iodo-4,5,6,7-tetrahydro-1H-indazol-7-amine |
|---|---|
| PubChem CID | 155973791 |
| Molecular Formula | C7H10IN3 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 3-iodo-4,5,6,7-tetrahydro-1H-indazol-7-amine |
| SMILES | NC1CCCc2c(I)n[nH]c21 |
| InChI | InChI=1S/C7H10IN3/c8-7-4-2-1-3-5(9)6(4)10-11-7/h5H,1-3,9H2,(H,10,11) |
| InChIKey | YXYIFUOYRJXBSZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|