About (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride
(1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride (PubChem CID 155973796) has the molecular formula C7H10ClN
and a molecular weight of 143.62 g/mol. Its IUPAC name is (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride.
Molecular Properties
| Compound Name | (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride |
| PubChem CID | 155973796 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride |
| SMILES | C#CC1[C@H]2CNC[C@@H]12.Cl |
| InChI | InChI=1S/C7H9N.ClH/c1-2-5-6-3-8-4-7(5)6;/h1,5-8H,3-4H2;1H/t5?,6-,7+; |
| InChIKey | GCKYDXZKJXIYBA-FXFNDYDPSA-N |
| XLogP | 0.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride?
The IUPAC name of (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride (CID 155973796) is (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride.
What is the SMILES notation for (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride?
The canonical SMILES for (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride is C#CC1[C@H]2CNC[C@@H]12.Cl.
What is the InChIKey of (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride?
The InChIKey is GCKYDXZKJXIYBA-FXFNDYDPSA-N. The full InChI is InChI=1S/C7H9N.ClH/c1-2-5-6-3-8-4-7(5)6;/h1,5-8H,3-4H2;1H/t5?,6-,7+;.
What are the key properties of (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride?
(1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride has a molecular weight of 143.62 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-6-ethynyl-3-azabicyclo[3.1.0]hexane;hydrochloride is sourced from PubChem (CID 155973796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).