About 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride
3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride (PubChem CID 155973812) has the molecular formula C5H8ClF2N
and a molecular weight of 155.58 g/mol. Its IUPAC name is 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride |
| PubChem CID | 155973812 |
| Molecular Formula | C5H8ClF2N |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride |
| SMILES | Cl.FC1(F)C=CCNC1 |
| InChI | InChI=1S/C5H7F2N.ClH/c6-5(7)2-1-3-8-4-5;/h1-2,8H,3-4H2;1H |
| InChIKey | DBYHJJBKBNCPAY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride?
The IUPAC name of 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride (CID 155973812) is 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride.
What is the SMILES notation for 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride?
The canonical SMILES for 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride is Cl.FC1(F)C=CCNC1.
What is the InChIKey of 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride?
The InChIKey is DBYHJJBKBNCPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N.ClH/c6-5(7)2-1-3-8-4-5;/h1-2,8H,3-4H2;1H.
What are the key properties of 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride?
3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride has a molecular weight of 155.58 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-2,6-dihydro-1H-pyridine;hydrochloride is sourced from PubChem (CID 155973812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).