C15H18N4OS — CID 155975796
4-[3-[(3-methyl-4-pyridinyl)oxy]pyrrolidin-1-yl]-2-methylsulfanylpyrimidine (PubChem CID 155975796) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-[3-[(3-methyl-4-pyridinyl)oxy]pyrrolidin-1-yl]-2-methylsulfanylpyrimidine.
| Compound Name | 4-[3-[(3-methyl-4-pyridinyl)oxy]pyrrolidin-1-yl]-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 155975796 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-[3-[(3-methyl-4-pyridinyl)oxy]pyrrolidin-1-yl]-2-methylsulfanylpyrimidine |
| SMILES | CSc1nccc(N2CCC(Oc3ccncc3C)C2)n1 |
| InChI | InChI=1S/C15H18N4OS/c1-11-9-16-6-3-13(11)20-12-5-8-19(10-12)14-4-7-17-15(18-14)21-2/h3-4,6-7,9,12H,5,8,10H2,1-2H3 |
| InChIKey | UWFPLSNGFCOYCL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |