C19H20FN5 — CID 155976434
N-[1-(6-fluoroquinazolin-4-yl)piperidin-4-yl]-N-methylpyridin-2-amine (PubChem CID 155976434) has the molecular formula C19H20FN5 and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[1-(6-fluoroquinazolin-4-yl)piperidin-4-yl]-N-methylpyridin-2-amine.
| Compound Name | N-[1-(6-fluoroquinazolin-4-yl)piperidin-4-yl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 155976434 |
| Molecular Formula | C19H20FN5 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[1-(6-fluoroquinazolin-4-yl)piperidin-4-yl]-N-methylpyridin-2-amine |
| SMILES | CN(c1ccccn1)C1CCN(c2ncnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C19H20FN5/c1-24(18-4-2-3-9-21-18)15-7-10-25(11-8-15)19-16-12-14(20)5-6-17(16)22-13-23-19/h2-6,9,12-13,15H,7-8,10-11H2,1H3 |
| InChIKey | IQMLZVCONXCFBI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |