C14H20N6O2S — CID 155976789
3-ethyl-6-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 155976789) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 3-ethyl-6-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-ethyl-6-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 155976789 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-ethyl-6-(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCc1nnc2ccc(N3CC4CN(S(C)(=O)=O)CC4C3)nn12 |
| InChI | InChI=1S/C14H20N6O2S/c1-3-12-15-16-13-4-5-14(17-20(12)13)18-6-10-8-19(23(2,21)22)9-11(10)7-18/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | FMDGLJDNLUMJQF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |