About methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride
methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride (PubChem CID 155977912) has the molecular formula C8H14ClNO3
and a molecular weight of 207.66 g/mol. Its IUPAC name is methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride |
| PubChem CID | 155977912 |
| Molecular Formula | C8H14ClNO3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride |
| SMILES | COCC1(C(=O)OC)C=CCN1.Cl |
| InChI | InChI=1S/C8H13NO3.ClH/c1-11-6-8(7(10)12-2)4-3-5-9-8;/h3-4,9H,5-6H2,1-2H3;1H |
| InChIKey | IKUIRBVFNNANHH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride?
The IUPAC name of methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride (CID 155977912) is methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride is COCC1(C(=O)OC)C=CCN1.Cl.
What is the InChIKey of methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride?
The InChIKey is IKUIRBVFNNANHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.ClH/c1-11-6-8(7(10)12-2)4-3-5-9-8;/h3-4,9H,5-6H2,1-2H3;1H.
What are the key properties of methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride?
methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride has a molecular weight of 207.66 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(methoxymethyl)-1,2-dihydropyrrole-5-carboxylate;hydrochloride is sourced from PubChem (CID 155977912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).