C12H17BClN3O2 — CID 155977948
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine;hydrochloride (PubChem CID 155977948) has the molecular formula C12H17BClN3O2 and a molecular weight of 281.55 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine;hydrochloride.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 155977948 |
| Molecular Formula | C12H17BClN3O2 |
| Molecular Weight | 281.55 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine;hydrochloride |
| SMILES | CC1(C)OB(c2cnc3[nH]ncc3c2)OC1(C)C.Cl |
| InChI | InChI=1S/C12H16BN3O2.ClH/c1-11(2)12(3,4)18-13(17-11)9-5-8-6-15-16-10(8)14-7-9;/h5-7H,1-4H3,(H,14,15,16);1H |
| InChIKey | VNIRWLPWXRIASA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|