About 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride
3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride (PubChem CID 155977993) has the molecular formula C5H10ClN3O2
and a molecular weight of 179.61 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride |
| PubChem CID | 155977993 |
| Molecular Formula | C5H10ClN3O2 |
| Molecular Weight | 179.61 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride |
| SMILES | Cl.Cn1c(CCN)noc1=O |
| InChI | InChI=1S/C5H9N3O2.ClH/c1-8-4(2-3-6)7-10-5(8)9;/h2-3,6H2,1H3;1H |
| InChIKey | IXTLGNFSRITPFF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.61 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride?
The IUPAC name of 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride (CID 155977993) is 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride.
What is the SMILES notation for 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride?
The canonical SMILES for 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride is Cl.Cn1c(CCN)noc1=O.
What is the InChIKey of 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride?
The InChIKey is IXTLGNFSRITPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2.ClH/c1-8-4(2-3-6)7-10-5(8)9;/h2-3,6H2,1H3;1H.
What are the key properties of 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride?
3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride has a molecular weight of 179.61 g/mol, XLogP of -0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-4-methyl-1,2,4-oxadiazol-5-one;hydrochloride is sourced from PubChem (CID 155977993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).