C20H43NO3Sn — CID 155978071
(5R,6S)-2,2-dimethyl-6-(tributylstannylmethoxy)-1,3-dioxepan-5-amine (PubChem CID 155978071) has the molecular formula C20H43NO3Sn and a molecular weight of 464.28 g/mol. Its IUPAC name is (5R,6S)-2,2-dimethyl-6-(tributylstannylmethoxy)-1,3-dioxepan-5-amine.
| Compound Name | (5R,6S)-2,2-dimethyl-6-(tributylstannylmethoxy)-1,3-dioxepan-5-amine |
|---|---|
| PubChem CID | 155978071 |
| Molecular Formula | C20H43NO3Sn |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (5R,6S)-2,2-dimethyl-6-(tributylstannylmethoxy)-1,3-dioxepan-5-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@@H]1COC(C)(C)OC[C@H]1N |
| InChI | InChI=1S/C8H16NO3.3C4H9.Sn/c1-8(2)11-4-6(9)7(10-3)5-12-8;3*1-3-4-2;/h6-7H,3-5,9H2,1-2H3;3*1,3-4H2,2H3;/t6-,7-;;;;/m1..../s1 |
| InChIKey | REQXFTJZXINFAP-GPNPRUALSA-N |
| XLogP | 4.87 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |