About [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride
[1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride (PubChem CID 155978316) has the molecular formula C6H8Cl2N4
and a molecular weight of 207.06 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride.
Molecular Properties
| Compound Name | [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride |
| PubChem CID | 155978316 |
| Molecular Formula | C6H8Cl2N4 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccn2cnnc12 |
| InChI | InChI=1S/C6H6N4.2ClH/c7-5-2-1-3-10-4-8-9-6(5)10;;/h1-4H,7H2;2*1H |
| InChIKey | CYWUKCBLKSGNSB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride?
The IUPAC name of [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride (CID 155978316) is [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride.
What is the SMILES notation for [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride?
The canonical SMILES for [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride is Cl.Cl.Nc1cccn2cnnc12.
What is the InChIKey of [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride?
The InChIKey is CYWUKCBLKSGNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.2ClH/c7-5-2-1-3-10-4-8-9-6(5)10;;/h1-4H,7H2;2*1H.
What are the key properties of [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride?
[1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride has a molecular weight of 207.06 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[4,3-a]pyridin-8-amine;dihydrochloride is sourced from PubChem (CID 155978316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).