C10H12ClF3N2 — CID 155978324
1-[6-(trifluoromethyl)-3-pyridinyl]cyclobutan-1-amine;hydrochloride (PubChem CID 155978324) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-3-pyridinyl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 1-[6-(trifluoromethyl)-3-pyridinyl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 155978324 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-[6-(trifluoromethyl)-3-pyridinyl]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2ccc(C(F)(F)F)nc2)CCC1 |
| InChI | InChI=1S/C10H11F3N2.ClH/c11-10(12,13)8-3-2-7(6-15-8)9(14)4-1-5-9;/h2-3,6H,1,4-5,14H2;1H |
| InChIKey | HXQGEQKBHRVCHU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |