About [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride
[(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride (PubChem CID 155978477) has the molecular formula C6H14ClNO3
and a molecular weight of 183.63 g/mol. Its IUPAC name is [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride |
| PubChem CID | 155978477 |
| Molecular Formula | C6H14ClNO3 |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride |
| SMILES | Cl.NC[C@@H]1CO[C@@H](CO)CO1 |
| InChI | InChI=1S/C6H13NO3.ClH/c7-1-5-3-10-6(2-8)4-9-5;/h5-6,8H,1-4,7H2;1H/t5-,6+;/m1./s1 |
| InChIKey | YRANRXNAUQXRRG-IBTYICNHSA-N |
| XLogP | -0.86 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.63 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride?
The IUPAC name of [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride (CID 155978477) is [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride?
The canonical SMILES for [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride is Cl.NC[C@@H]1CO[C@@H](CO)CO1.
What is the InChIKey of [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride?
The InChIKey is YRANRXNAUQXRRG-IBTYICNHSA-N. The full InChI is InChI=1S/C6H13NO3.ClH/c7-1-5-3-10-6(2-8)4-9-5;/h5-6,8H,1-4,7H2;1H/t5-,6+;/m1./s1.
What are the key properties of [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride?
[(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride has a molecular weight of 183.63 g/mol, XLogP of -0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-(aminomethyl)-1,4-dioxan-2-yl]methanol;hydrochloride is sourced from PubChem (CID 155978477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).