C20H22O7 — CID 155978958
[(3S,8R,9E,12R)-5-(hydroxymethyl)-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-3-yl] (Z)-2-methylbut-2-enoate (PubChem CID 155978958) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(3S,8R,9E,12R)-5-(hydroxymethyl)-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-3-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3S,8R,9E,12R)-5-(hydroxymethyl)-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-3-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 155978958 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(3S,8R,9E,12R)-5-(hydroxymethyl)-10-methyl-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),4,9-trien-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CC2=C[C@@H](C/C(C)=C/[C@H]3OC(=O)C(CO)=C13)OC2=O |
| InChI | InChI=1S/C20H22O7/c1-4-11(3)18(22)26-16-8-12-7-13(25-19(12)23)5-10(2)6-15-17(16)14(9-21)20(24)27-15/h4,6-7,13,15-16,21H,5,8-9H2,1-3H3/b10-6+,11-4-/t13-,15-,16+/m1/s1 |
| InChIKey | DFUFHQYYQXCXKV-XFIUFDCLSA-N |
| XLogP | 1.67 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|