C23H40N4O3 — CID 155979294
2-[(3S,3aR,4S,6aS)-4-[2-(diethylamino)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide (PubChem CID 155979294) has the molecular formula C23H40N4O3 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-4-[2-(diethylamino)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-4-[2-(diethylamino)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 155979294 |
| Molecular Formula | C23H40N4O3 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-4-[2-(diethylamino)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
| SMILES | CCN(CC)C(=O)C[C@@H]1OC[C@@H]2[C@H]1[C@H](CC(=O)NC1CC1)CN2C1CCN(C)CC1 |
| InChI | InChI=1S/C23H40N4O3/c1-4-26(5-2)22(29)13-20-23-16(12-21(28)24-17-6-7-17)14-27(19(23)15-30-20)18-8-10-25(3)11-9-18/h16-20,23H,4-15H2,1-3H3,(H,24,28)/t16-,19-,20+,23-/m1/s1 |
| InChIKey | HIMINLPJIINJIG-LOODEUFTSA-N |
| XLogP | 1.32 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |