C21H35N3O3 — CID 155979393
2-[(3S,3aR,4S,6aS)-1-(cyclopropylmethyl)-4-[2-(diethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide (PubChem CID 155979393) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-1-(cyclopropylmethyl)-4-[2-(diethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-1-(cyclopropylmethyl)-4-[2-(diethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 155979393 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-1-(cyclopropylmethyl)-4-[2-(diethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
| SMILES | CCN(CC)C(=O)C[C@@H]1OC[C@@H]2[C@H]1[C@H](CC(=O)NC1CC1)CN2CC1CC1 |
| InChI | InChI=1S/C21H35N3O3/c1-3-23(4-2)20(26)10-18-21-15(9-19(25)22-16-7-8-16)12-24(11-14-5-6-14)17(21)13-27-18/h14-18,21H,3-13H2,1-2H3,(H,22,25)/t15-,17-,18+,21-/m1/s1 |
| InChIKey | HOARGUHYUZDDOR-LAVAIGHBSA-N |
| XLogP | 1.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |