C20H33N3O4 — CID 155979403
2-[(3S,3aR,4S,6aS)-1-(oxetan-3-yl)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide (PubChem CID 155979403) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-1-(oxetan-3-yl)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-1-(oxetan-3-yl)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 155979403 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-1-(oxetan-3-yl)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C[C@@H]1CN(C2COC2)[C@@H]2CO[C@@H](CC(=O)N3CCCC3)[C@H]12 |
| InChI | InChI=1S/C20H33N3O4/c1-13(2)21-18(24)7-14-9-23(15-10-26-11-15)16-12-27-17(20(14)16)8-19(25)22-5-3-4-6-22/h13-17,20H,3-12H2,1-2H3,(H,21,24)/t14-,16-,17+,20-/m1/s1 |
| InChIKey | IIBCHKZXMWPEML-DFYYWFRZSA-N |
| XLogP | 0.63 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |