C7H13N2O5P — CID 15598013
[acetyl-(2-oxopyrrolidin-3-yl)amino]methylphosphonic acid (PubChem CID 15598013) has the molecular formula C7H13N2O5P and a molecular weight of 236.16 g/mol. Its IUPAC name is [acetyl-(2-oxopyrrolidin-3-yl)amino]methylphosphonic acid.
| Compound Name | [acetyl-(2-oxopyrrolidin-3-yl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 15598013 |
| Molecular Formula | C7H13N2O5P |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [acetyl-(2-oxopyrrolidin-3-yl)amino]methylphosphonic acid |
| SMILES | CC(=O)N(CP(=O)(O)O)C1CCNC1=O |
| InChI | InChI=1S/C7H13N2O5P/c1-5(10)9(4-15(12,13)14)6-2-3-8-7(6)11/h6H,2-4H2,1H3,(H,8,11)(H2,12,13,14) |
| InChIKey | CTLHPUUPEWGIBL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|