C12H20N4O5 — CID 15598028
6-(2,2-diethoxyethylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione (PubChem CID 15598028) has the molecular formula C12H20N4O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 6-(2,2-diethoxyethylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione.
| Compound Name | 6-(2,2-diethoxyethylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15598028 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-(2,2-diethoxyethylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione |
| SMILES | CCOC(CNc1c(N=O)c(=O)n(C)c(=O)n1C)OCC |
| InChI | InChI=1S/C12H20N4O5/c1-5-20-8(21-6-2)7-13-10-9(14-19)11(17)16(4)12(18)15(10)3/h8,13H,5-7H2,1-4H3 |
| InChIKey | ITQZMYZSHNLOOQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|