C19H17N3O4 — CID 155981880
2-[2-[3-[(2-methyl-4-pyridinyl)oxy]azetidin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 155981880) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[2-[3-[(2-methyl-4-pyridinyl)oxy]azetidin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[3-[(2-methyl-4-pyridinyl)oxy]azetidin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155981880 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[2-[3-[(2-methyl-4-pyridinyl)oxy]azetidin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(OC2CN(C(=O)CN3C(=O)c4ccccc4C3=O)C2)ccn1 |
| InChI | InChI=1S/C19H17N3O4/c1-12-8-13(6-7-20-12)26-14-9-21(10-14)17(23)11-22-18(24)15-4-2-3-5-16(15)19(22)25/h2-8,14H,9-11H2,1H3 |
| InChIKey | ZOYKSRASYMIZTB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|