About propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid
propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 155981951) has the molecular formula C14H18F3N3O4
and a molecular weight of 349.31 g/mol. Its IUPAC name is propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid |
| PubChem CID | 155981951 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCCOC(=O)c1cnc(C2CCCN2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3O2.C2HF3O2/c1-2-6-17-12(16)11-8-14-10(7-15-11)9-4-3-5-13-9;3-2(4,5)1(6)7/h7-9,13H,2-6H2,1H3;(H,6,7) |
| InChIKey | GNZLSEUNPMPIMO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid?
The IUPAC name of propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid (CID 155981951) is propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid?
The canonical SMILES for propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid is CCCOC(=O)c1cnc(C2CCCN2)cn1.O=C(O)C(F)(F)F.
What is the InChIKey of propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid?
The InChIKey is GNZLSEUNPMPIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2.C2HF3O2/c1-2-6-17-12(16)11-8-14-10(7-15-11)9-4-3-5-13-9;3-2(4,5)1(6)7/h7-9,13H,2-6H2,1H3;(H,6,7).
What are the key properties of propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid?
propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid has a molecular weight of 349.31 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 5-pyrrolidin-2-ylpyrazine-2-carboxylate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 155981951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).