About N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide
N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide (PubChem CID 155982013) has the molecular formula C17H19IN2O2S
and a molecular weight of 442.32 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide |
| PubChem CID | 155982013 |
| Molecular Formula | C17H19IN2O2S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide |
| SMILES | Cc1cc(C)c(CCN(C#Cc2ccc(I)cc2)S(C)(=O)=O)[nH]1 |
| InChI | InChI=1S/C17H19IN2O2S/c1-13-12-14(2)19-17(13)9-11-20(23(3,21)22)10-8-15-4-6-16(18)7-5-15/h4-7,12,19H,9,11H2,1-3H3 |
| InChIKey | ZLKHKOWMQKZCMX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide?
The IUPAC name of N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide (CID 155982013) is N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide.
What is the SMILES notation for N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide?
The canonical SMILES for N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide is Cc1cc(C)c(CCN(C#Cc2ccc(I)cc2)S(C)(=O)=O)[nH]1.
What is the InChIKey of N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide?
The InChIKey is ZLKHKOWMQKZCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19IN2O2S/c1-13-12-14(2)19-17(13)9-11-20(23(3,21)22)10-8-15-4-6-16(18)7-5-15/h4-7,12,19H,9,11H2,1-3H3.
What are the key properties of N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide?
N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide has a molecular weight of 442.32 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-[2-(4-iodophenyl)ethynyl]methanesulfonamide is sourced from PubChem (CID 155982013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).