C6HF13O2 — CID 155982319
1,1,2,2,3,3-hexafluoro-1-(1,2,2,2-tetrafluoroethoxy)-3-(trifluoromethoxy)propane (PubChem CID 155982319) has the molecular formula C6HF13O2 and a molecular weight of 352.05 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1-(1,2,2,2-tetrafluoroethoxy)-3-(trifluoromethoxy)propane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1-(1,2,2,2-tetrafluoroethoxy)-3-(trifluoromethoxy)propane |
|---|---|
| PubChem CID | 155982319 |
| Molecular Formula | C6HF13O2 |
| Molecular Weight | 352.05 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1-(1,2,2,2-tetrafluoroethoxy)-3-(trifluoromethoxy)propane |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6HF13O2/c7-1(2(8,9)10)20-4(13,14)3(11,12)5(15,16)21-6(17,18)19/h1H |
| InChIKey | JPMFKQBIYVBUAD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|