C12H15N5S — CID 155982517
N-(4-piperidin-4-ylpyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 155982517) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(4-piperidin-4-ylpyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-piperidin-4-ylpyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155982517 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(4-piperidin-4-ylpyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | c1cc(C2CCNCC2)nc(Nc2nccs2)n1 |
| InChI | InChI=1S/C12H15N5S/c1-4-13-5-2-9(1)10-3-6-14-11(16-10)17-12-15-7-8-18-12/h3,6-9,13H,1-2,4-5H2,(H,14,15,16,17) |
| InChIKey | JRKUFXQSKBYPPJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |