C14H24N4 — CID 155982518
(3aR,8aR)-4-methyl-1-[(3-methylimidazol-4-yl)methyl]-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepine (PubChem CID 155982518) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3aR,8aR)-4-methyl-1-[(3-methylimidazol-4-yl)methyl]-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepine.
| Compound Name | (3aR,8aR)-4-methyl-1-[(3-methylimidazol-4-yl)methyl]-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepine |
|---|---|
| PubChem CID | 155982518 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (3aR,8aR)-4-methyl-1-[(3-methylimidazol-4-yl)methyl]-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepine |
| SMILES | CN1CCCC[C@@H]2[C@H]1CCN2Cc1cncn1C |
| InChI | InChI=1S/C14H24N4/c1-16-7-4-3-5-14-13(16)6-8-18(14)10-12-9-15-11-17(12)2/h9,11,13-14H,3-8,10H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | VFCBINLSGHGPQE-ZIAGYGMSSA-N |
| XLogP | 1.48 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |