C17H17FN2O2 — CID 155983401
2-(3-fluorophenyl)-1-(2-pyridin-4-ylmorpholin-4-yl)ethanone (PubChem CID 155983401) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(2-pyridin-4-ylmorpholin-4-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-(2-pyridin-4-ylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 155983401 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(2-pyridin-4-ylmorpholin-4-yl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCOC(c2ccncc2)C1 |
| InChI | InChI=1S/C17H17FN2O2/c18-15-3-1-2-13(10-15)11-17(21)20-8-9-22-16(12-20)14-4-6-19-7-5-14/h1-7,10,16H,8-9,11-12H2 |
| InChIKey | MVYJAOKXFCNYCT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |