C21H38O4Si — CID 15598362
ethyl 8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 15598362) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is ethyl 8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | ethyl 8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 15598362 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | ethyl 8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1C(C)C=CC2CC(CO)CC(O[Si](C)(C)C(C)(C)C)C21 |
| InChI | InChI=1S/C21H38O4Si/c1-8-24-20(23)18-14(2)9-10-16-11-15(13-22)12-17(19(16)18)25-26(6,7)21(3,4)5/h9-10,14-19,22H,8,11-13H2,1-7H3 |
| InChIKey | GXHPQSNOQBLUNI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|