C23H28N2O3 — CID 155984245
[(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[3-(2-aminoethoxy)phenyl]methanone (PubChem CID 155984245) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[3-(2-aminoethoxy)phenyl]methanone.
| Compound Name | [(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[3-(2-aminoethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 155984245 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(3aS,6aR)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[3-(2-aminoethoxy)phenyl]methanone |
| SMILES | NCCOc1cccc(C(=O)N2C[C@H]3CC(OCc4ccccc4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C23H28N2O3/c24-9-10-27-21-8-4-7-18(11-21)23(26)25-14-19-12-22(13-20(19)15-25)28-16-17-5-2-1-3-6-17/h1-8,11,19-20,22H,9-10,12-16,24H2/t19-,20+,22? |
| InChIKey | WBZYQUBZNVPEGP-RLAPIPATSA-N |
| XLogP | 3.09 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |