C27H40N4O6S — CID 155984570
(1R,14R,19S,21E,24R)-N,N-diethyl-3,12-dioxo-10,26-dioxa-2,13,18-triazatetracyclo[22.4.0.04,9.014,19]octacosa-4,6,8,21-tetraene-18-sulfonamide (PubChem CID 155984570) has the molecular formula C27H40N4O6S and a molecular weight of 548.71 g/mol. Its IUPAC name is (1R,14R,19S,21E,24R)-N,N-diethyl-3,12-dioxo-10,26-dioxa-2,13,18-triazatetracyclo[22.4.0.04,9.014,19]octacosa-4,6,8,21-tetraene-18-sulfonamide.
| Compound Name | (1R,14R,19S,21E,24R)-N,N-diethyl-3,12-dioxo-10,26-dioxa-2,13,18-triazatetracyclo[22.4.0.04,9.014,19]octacosa-4,6,8,21-tetraene-18-sulfonamide |
|---|---|
| PubChem CID | 155984570 |
| Molecular Formula | C27H40N4O6S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (1R,14R,19S,21E,24R)-N,N-diethyl-3,12-dioxo-10,26-dioxa-2,13,18-triazatetracyclo[22.4.0.04,9.014,19]octacosa-4,6,8,21-tetraene-18-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC[C@H]2NC(=O)COc3ccccc3C(=O)N[C@@H]3CCOC[C@@H]3C/C=C/C[C@@H]21 |
| InChI | InChI=1S/C27H40N4O6S/c1-3-30(4-2)38(34,35)31-16-9-12-23-24(31)13-7-5-10-20-18-36-17-15-22(20)29-27(33)21-11-6-8-14-25(21)37-19-26(32)28-23/h5-8,11,14,20,22-24H,3-4,9-10,12-13,15-19H2,1-2H3,(H,28,32)(H,29,33)/b7-5+/t20-,22+,23+,24-/m0/s1 |
| InChIKey | ZQASBLSKVTZVEJ-JXAKQUJNSA-N |
| XLogP | 2.09 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|