C24H31N3O3 — CID 155984604
2-acetamido-N-[(1R,2S,3R)-3-(2-benzylanilino)-2-hydroxycyclohexyl]-N-methylacetamide (PubChem CID 155984604) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-acetamido-N-[(1R,2S,3R)-3-(2-benzylanilino)-2-hydroxycyclohexyl]-N-methylacetamide.
| Compound Name | 2-acetamido-N-[(1R,2S,3R)-3-(2-benzylanilino)-2-hydroxycyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 155984604 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-acetamido-N-[(1R,2S,3R)-3-(2-benzylanilino)-2-hydroxycyclohexyl]-N-methylacetamide |
| SMILES | CC(=O)NCC(=O)N(C)[C@@H]1CCC[C@@H](Nc2ccccc2Cc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C24H31N3O3/c1-17(28)25-16-23(29)27(2)22-14-8-13-21(24(22)30)26-20-12-7-6-11-19(20)15-18-9-4-3-5-10-18/h3-7,9-12,21-22,24,26,30H,8,13-16H2,1-2H3,(H,25,28)/t21-,22-,24+/m1/s1 |
| InChIKey | XWNOAWDYHLOSJV-AKFKNWHVSA-N |
| XLogP | 2.57 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |