C22H32N2O — CID 155984801
(2S,3aS,9aS)-1-cyclohexyl-3a-methyl-2-phenyl-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one (PubChem CID 155984801) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is (2S,3aS,9aS)-1-cyclohexyl-3a-methyl-2-phenyl-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one.
| Compound Name | (2S,3aS,9aS)-1-cyclohexyl-3a-methyl-2-phenyl-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 155984801 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | (2S,3aS,9aS)-1-cyclohexyl-3a-methyl-2-phenyl-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
| SMILES | C[C@]12C[C@@H](c3ccccc3)N(C3CCCCC3)[C@H]1CCCCC(=O)N2 |
| InChI | InChI=1S/C22H32N2O/c1-22-16-19(17-10-4-2-5-11-17)24(18-12-6-3-7-13-18)20(22)14-8-9-15-21(25)23-22/h2,4-5,10-11,18-20H,3,6-9,12-16H2,1H3,(H,23,25)/t19-,20-,22-/m0/s1 |
| InChIKey | ZKFVXMWIVVLCKC-ONTIZHBOSA-N |
| XLogP | 4.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |