C24H29FN2O — CID 155985816
(3aR,4S,8aS)-3-(4-fluorophenyl)-1-(2-methylpropyl)-4-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d]imidazol-2-one (PubChem CID 155985816) has the molecular formula C24H29FN2O and a molecular weight of 380.51 g/mol. Its IUPAC name is (3aR,4S,8aS)-3-(4-fluorophenyl)-1-(2-methylpropyl)-4-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d]imidazol-2-one.
| Compound Name | (3aR,4S,8aS)-3-(4-fluorophenyl)-1-(2-methylpropyl)-4-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d]imidazol-2-one |
|---|---|
| PubChem CID | 155985816 |
| Molecular Formula | C24H29FN2O |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (3aR,4S,8aS)-3-(4-fluorophenyl)-1-(2-methylpropyl)-4-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d]imidazol-2-one |
| SMILES | CC(C)CN1C(=O)N(c2ccc(F)cc2)[C@@H]2[C@H](c3ccccc3)CCCC[C@@H]21 |
| InChI | InChI=1S/C24H29FN2O/c1-17(2)16-26-22-11-7-6-10-21(18-8-4-3-5-9-18)23(22)27(24(26)28)20-14-12-19(25)13-15-20/h3-5,8-9,12-15,17,21-23H,6-7,10-11,16H2,1-2H3/t21-,22-,23+/m0/s1 |
| InChIKey | PEPXZONKCHZXMK-RJGXRXQPSA-N |
| XLogP | 5.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |