C23H40N2O7S — CID 15598616
(2-methoxy-2-oxoethyl) (2S)-1-[2-[[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 15598616) has the molecular formula C23H40N2O7S and a molecular weight of 488.65 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) (2S)-1-[2-[[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | (2-methoxy-2-oxoethyl) (2S)-1-[2-[[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15598616 |
| Molecular Formula | C23H40N2O7S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (2-methoxy-2-oxoethyl) (2S)-1-[2-[[(2R)-1-ethoxy-3-heptylsulfanyl-1-oxopropan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCSC[C@H](NC(C)C(=O)N1CCC[C@H]1C(=O)OCC(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C23H40N2O7S/c1-5-7-8-9-10-14-33-16-18(22(28)31-6-2)24-17(3)21(27)25-13-11-12-19(25)23(29)32-15-20(26)30-4/h17-19,24H,5-16H2,1-4H3/t17?,18-,19-/m0/s1 |
| InChIKey | OHVHSWZUWSHRQN-MNNMKWMVSA-N |
| XLogP | 2.31 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|