C21H25N7O — CID 155987161
N-[(3S,7aS)-5-methyl-3-phenyl-2-(7H-purin-6-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide (PubChem CID 155987161) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[(3S,7aS)-5-methyl-3-phenyl-2-(7H-purin-6-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide.
| Compound Name | N-[(3S,7aS)-5-methyl-3-phenyl-2-(7H-purin-6-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide |
|---|---|
| PubChem CID | 155987161 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[(3S,7aS)-5-methyl-3-phenyl-2-(7H-purin-6-yl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CCN(C)CC1[C@@H](c1ccccc1)N(c1ncnc3nc[nH]c13)C2 |
| InChI | InChI=1S/C21H25N7O/c1-14(29)26-21-8-9-27(2)10-16(21)18(15-6-4-3-5-7-15)28(11-21)20-17-19(23-12-22-17)24-13-25-20/h3-7,12-13,16,18H,8-11H2,1-2H3,(H,26,29)(H,22,23,24,25)/t16?,18-,21-/m1/s1 |
| InChIKey | HCXKUCCNSBKYNN-QHNQYTFYSA-N |
| XLogP | 1.74 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |