C20H21FN6O — CID 155987172
4-[(4-fluorophenyl)methyl]-1-(7H-purin-6-yl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one (PubChem CID 155987172) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-1-(7H-purin-6-yl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one.
| Compound Name | 4-[(4-fluorophenyl)methyl]-1-(7H-purin-6-yl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one |
|---|---|
| PubChem CID | 155987172 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-1-(7H-purin-6-yl)-3,3a,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-5-one |
| SMILES | O=C1CCCC2C(CCN2c2ncnc3nc[nH]c23)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN6O/c21-14-6-4-13(5-7-14)10-27-16-8-9-26(15(16)2-1-3-17(27)28)20-18-19(23-11-22-18)24-12-25-20/h4-7,11-12,15-16H,1-3,8-10H2,(H,22,23,24,25) |
| InChIKey | PAWYSYMNGABKLF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |