C13H20O4 — CID 155987628
(3S,4S)-3,4-dihydroxy-2,2,7,7-tetramethyl-3,4,6,8-tetrahydrochromen-5-one (PubChem CID 155987628) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-2,2,7,7-tetramethyl-3,4,6,8-tetrahydrochromen-5-one.
| Compound Name | (3S,4S)-3,4-dihydroxy-2,2,7,7-tetramethyl-3,4,6,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 155987628 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-2,2,7,7-tetramethyl-3,4,6,8-tetrahydrochromen-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(C)(C)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C13H20O4/c1-12(2)5-7(14)9-8(6-12)17-13(3,4)11(16)10(9)15/h10-11,15-16H,5-6H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | GMRKXAXIQRSDBL-QWRGUYRKSA-N |
| XLogP | 1.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |