C10H14N2O — CID 15598790
(NE)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)but-3-ynylidene]hydroxylamine (PubChem CID 15598790) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (NE)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)but-3-ynylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)but-3-ynylidene]hydroxylamine |
|---|---|
| PubChem CID | 15598790 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (NE)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)but-3-ynylidene]hydroxylamine |
| SMILES | C#CC/C(=N\O)C1=CCCN(C)C1 |
| InChI | InChI=1S/C10H14N2O/c1-3-5-10(11-13)9-6-4-7-12(2)8-9/h1,6,13H,4-5,7-8H2,2H3/b11-10+ |
| InChIKey | WDFNOKKLPDGLSR-ZHACJKMWSA-N |
| XLogP | 1.10 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|