C25H33NO3 — CID 155988867
2-methyl-N-(2-propan-2-yloxyethyl)-2-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-5-carboxamide (PubChem CID 155988867) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 2-methyl-N-(2-propan-2-yloxyethyl)-2-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-5-carboxamide.
| Compound Name | 2-methyl-N-(2-propan-2-yloxyethyl)-2-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 155988867 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 2-methyl-N-(2-propan-2-yloxyethyl)-2-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-5-carboxamide |
| SMILES | CC(C)OCCNC(=O)c1ccc2c(c1)CC(C)(Cc1ccc(C(C)C)cc1)O2 |
| InChI | InChI=1S/C25H33NO3/c1-17(2)20-8-6-19(7-9-20)15-25(5)16-22-14-21(10-11-23(22)29-25)24(27)26-12-13-28-18(3)4/h6-11,14,17-18H,12-13,15-16H2,1-5H3,(H,26,27) |
| InChIKey | HRRWZEJCKQHULG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|