C15H19BrClNO4 — CID 15599075
6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium perchlorate (PubChem CID 15599075) has the molecular formula C15H19BrClNO4 and a molecular weight of 392.68 g/mol. Its IUPAC name is 6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium perchlorate.
| Compound Name | 6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium perchlorate |
|---|---|
| PubChem CID | 15599075 |
| Molecular Formula | C15H19BrClNO4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium perchlorate |
| SMILES | Brc1ccccc1C1=[N+]2CCCCC2CCC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H19BrN.ClHO4/c16-14-9-2-1-8-13(14)15-10-5-7-12-6-3-4-11-17(12)15;2-1(3,4)5/h1-2,8-9,12H,3-7,10-11H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | MRIVSNKUFXUOLS-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|