C15H20BrN — CID 15599085
4-(2-bromophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 15599085) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is 4-(2-bromophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 4-(2-bromophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 15599085 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-(2-bromophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | Brc1ccccc1C1CCCC2CCCCN21 |
| InChI | InChI=1S/C15H20BrN/c16-14-9-2-1-8-13(14)15-10-5-7-12-6-3-4-11-17(12)15/h1-2,8-9,12,15H,3-7,10-11H2 |
| InChIKey | QWCNZYVREXQZKI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |