C23H29N5O4S — CID 155992105
N-[[(3S,4R)-1-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]phenyl]methyl]-3,4-dihydroxypyrrolidin-3-yl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 155992105) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[[(3S,4R)-1-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]phenyl]methyl]-3,4-dihydroxypyrrolidin-3-yl]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[(3S,4R)-1-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]phenyl]methyl]-3,4-dihydroxypyrrolidin-3-yl]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155992105 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[[(3S,4R)-1-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]phenyl]methyl]-3,4-dihydroxypyrrolidin-3-yl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(C)n(CCOc2ccc(CN3C[C@@H](O)[C@](O)(CNC(=O)c4cscn4)C3)cc2)n1 |
| InChI | InChI=1S/C23H29N5O4S/c1-16-9-17(2)28(26-16)7-8-32-19-5-3-18(4-6-19)10-27-11-21(29)23(31,14-27)13-24-22(30)20-12-33-15-25-20/h3-6,9,12,15,21,29,31H,7-8,10-11,13-14H2,1-2H3,(H,24,30)/t21-,23+/m1/s1 |
| InChIKey | KOHGPABOQGRMFT-GGAORHGYSA-N |
| XLogP | 1.37 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |