C6H11NO5 — CID 15599233
(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid (PubChem CID 15599233) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 15599233 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1NC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO5/c8-2-1-7-3(6(11)12)5(10)4(2)9/h2-5,7-10H,1H2,(H,11,12)/t2-,3+,4+,5+/m0/s1 |
| InChIKey | ZHFMVVUVCALAMY-NRXMZTRTSA-N |
| XLogP | -2.87 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |