(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid

C6H11NO5 — CID 15599233

IUPAC(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
InChIInChI=1S/C6H11NO5/c8-2-1-7-3(6(11)12)5(10)4(2)9/h2-5,7-10H,1H2,(H,11,12)/t2-,3+,4+,5+/m0/s1
InChIKeyZHFMVVUVCALAMY-NRXMZTRTSA-N
MW177.16 g/mol
LogP-2.87
Rot. Bonds1

About (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid

(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid (PubChem CID 15599233) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid.

Molecular Properties

Compound Name(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid
PubChem CID15599233
Molecular FormulaC6H11NO5
Molecular Weight177.16 g/mol
Exact Mass177.06
IUPAC Name(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
InChIInChI=1S/C6H11NO5/c8-2-1-7-3(6(11)12)5(10)4(2)9/h2-5,7-10H,1H2,(H,11,12)/t2-,3+,4+,5+/m0/s1
InChIKeyZHFMVVUVCALAMY-NRXMZTRTSA-N
XLogP-2.87
TPSA110.02 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 5-2.87
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid?
The IUPAC name of (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid (CID 15599233) is (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid.
What is the SMILES notation for (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid?
The canonical SMILES for (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid is O=C(O)[C@@H]1NC[C@H](O)[C@@H](O)[C@@H]1O.
What is the InChIKey of (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid?
The InChIKey is ZHFMVVUVCALAMY-NRXMZTRTSA-N. The full InChI is InChI=1S/C6H11NO5/c8-2-1-7-3(6(11)12)5(10)4(2)9/h2-5,7-10H,1H2,(H,11,12)/t2-,3+,4+,5+/m0/s1.
What are the key properties of (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid?
(2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid has a molecular weight of 177.16 g/mol, XLogP of -2.87, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R,4R,5S)-3,4,5-trihydroxypiperidine-2-carboxylic acid is sourced from PubChem (CID 15599233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).