C23H33N5O — CID 155993473
(9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-(1-propylpyrazol-4-yl)methanone (PubChem CID 155993473) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is (9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-(1-propylpyrazol-4-yl)methanone.
| Compound Name | (9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-(1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 155993473 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (9,17-dimethyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl)-(1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1cc(C(=O)N2Cc3cccc(C)c3NCCC3CCC(C2)N3C)cn1 |
| InChI | InChI=1S/C23H33N5O/c1-4-12-28-15-19(13-25-28)23(29)27-14-18-7-5-6-17(2)22(18)24-11-10-20-8-9-21(16-27)26(20)3/h5-7,13,15,20-21,24H,4,8-12,14,16H2,1-3H3 |
| InChIKey | FVVQDURYBFOEQV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |