C30H40N2O7 — CID 155993521
(9R,10S)-1'-[3-(3,4-dimethoxyphenyl)propanoyl]-9,10-dihydroxy-5-methylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one (PubChem CID 155993521) has the molecular formula C30H40N2O7 and a molecular weight of 540.66 g/mol. Its IUPAC name is (9R,10S)-1'-[3-(3,4-dimethoxyphenyl)propanoyl]-9,10-dihydroxy-5-methylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one.
| Compound Name | (9R,10S)-1'-[3-(3,4-dimethoxyphenyl)propanoyl]-9,10-dihydroxy-5-methylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 155993521 |
| Molecular Formula | C30H40N2O7 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | (9R,10S)-1'-[3-(3,4-dimethoxyphenyl)propanoyl]-9,10-dihydroxy-5-methylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
| SMILES | COc1ccc(CCC(=O)N2CCC3(CC2)C[C@@H](O)[C@@H](O)Cc2ccccc2OCC(=O)N(C)C3)cc1OC |
| InChI | InChI=1S/C30H40N2O7/c1-31-20-30(18-24(34)23(33)17-22-6-4-5-7-25(22)39-19-29(31)36)12-14-32(15-13-30)28(35)11-9-21-8-10-26(37-2)27(16-21)38-3/h4-8,10,16,23-24,33-34H,9,11-15,17-20H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | MUZMPRHTSKNJSG-BJKOFHAPSA-N |
| XLogP | 2.45 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |