C33H47N3O8 — CID 155993571
(10R,11S)-10,11-dihydroxy-3-(pyridin-2-ylmethyl)-14-[3-(2,3,4-trimethoxyphenyl)propanoyl]-8-oxa-3,14-diazaspiro[5.12]octadecan-7-one (PubChem CID 155993571) has the molecular formula C33H47N3O8 and a molecular weight of 613.75 g/mol. Its IUPAC name is (10R,11S)-10,11-dihydroxy-3-(pyridin-2-ylmethyl)-14-[3-(2,3,4-trimethoxyphenyl)propanoyl]-8-oxa-3,14-diazaspiro[5.12]octadecan-7-one.
| Compound Name | (10R,11S)-10,11-dihydroxy-3-(pyridin-2-ylmethyl)-14-[3-(2,3,4-trimethoxyphenyl)propanoyl]-8-oxa-3,14-diazaspiro[5.12]octadecan-7-one |
|---|---|
| PubChem CID | 155993571 |
| Molecular Formula | C33H47N3O8 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | (10R,11S)-10,11-dihydroxy-3-(pyridin-2-ylmethyl)-14-[3-(2,3,4-trimethoxyphenyl)propanoyl]-8-oxa-3,14-diazaspiro[5.12]octadecan-7-one |
| SMILES | COc1ccc(CCC(=O)N2CCCCC3(CCN(Cc4ccccn4)CC3)C(=O)OC[C@@H](O)[C@@H](O)CC2)c(OC)c1OC |
| InChI | InChI=1S/C33H47N3O8/c1-41-28-11-9-24(30(42-2)31(28)43-3)10-12-29(39)36-18-7-5-14-33(32(40)44-23-27(38)26(37)13-19-36)15-20-35(21-16-33)22-25-8-4-6-17-34-25/h4,6,8-9,11,17,26-27,37-38H,5,7,10,12-16,18-23H2,1-3H3/t26-,27+/m0/s1 |
| InChIKey | AZSHSLQEJVHBNC-RRPNLBNLSA-N |
| XLogP | 2.99 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |