C34H50N2O7 — CID 155994564
(4S)-12-(2-methoxyethyl)-4-(2-methylpropyl)-5-[3-(2,3,4-trimethoxyphenyl)propanoyl]-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-trien-13-one (PubChem CID 155994564) has the molecular formula C34H50N2O7 and a molecular weight of 598.78 g/mol. Its IUPAC name is (4S)-12-(2-methoxyethyl)-4-(2-methylpropyl)-5-[3-(2,3,4-trimethoxyphenyl)propanoyl]-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-trien-13-one.
| Compound Name | (4S)-12-(2-methoxyethyl)-4-(2-methylpropyl)-5-[3-(2,3,4-trimethoxyphenyl)propanoyl]-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-trien-13-one |
|---|---|
| PubChem CID | 155994564 |
| Molecular Formula | C34H50N2O7 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | (4S)-12-(2-methoxyethyl)-4-(2-methylpropyl)-5-[3-(2,3,4-trimethoxyphenyl)propanoyl]-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(18),14,16-trien-13-one |
| SMILES | COCCN1CCCCCCN(C(=O)CCc2ccc(OC)c(OC)c2OC)[C@@H](CC(C)C)COc2ccccc2C1=O |
| InChI | InChI=1S/C34H50N2O7/c1-25(2)23-27-24-43-29-14-10-9-13-28(29)34(38)35(21-22-39-3)19-11-7-8-12-20-36(27)31(37)18-16-26-15-17-30(40-4)33(42-6)32(26)41-5/h9-10,13-15,17,25,27H,7-8,11-12,16,18-24H2,1-6H3/t27-/m0/s1 |
| InChIKey | PVXIFXQFSJWEDR-MHZLTWQESA-N |
| XLogP | 5.63 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |