About 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one
2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one (PubChem CID 15599468) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one |
| PubChem CID | 15599468 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one |
| SMILES | CC(C)C1OC2(C=CC1=O)CCCCO2 |
| InChI | InChI=1S/C12H18O3/c1-9(2)11-10(13)5-7-12(15-11)6-3-4-8-14-12/h5,7,9,11H,3-4,6,8H2,1-2H3 |
| InChIKey | AKKOSQGTXDVGIF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one?
The IUPAC name of 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one (CID 15599468) is 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one.
What is the SMILES notation for 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one?
The canonical SMILES for 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one is CC(C)C1OC2(C=CC1=O)CCCCO2.
What is the InChIKey of 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one?
The InChIKey is AKKOSQGTXDVGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-9(2)11-10(13)5-7-12(15-11)6-3-4-8-14-12/h5,7,9,11H,3-4,6,8H2,1-2H3.
What are the key properties of 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one?
2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one has a molecular weight of 210.27 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,7-dioxaspiro[5.5]undec-4-en-3-one is sourced from PubChem (CID 15599468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).