2-acetyloxyhexadecanoic acid

C18H34O4 — CID 15599534

IUPAC2-acetyloxyhexadecanoic acid
SMILESCCCCCCCCCCCCCCC(OC(C)=O)C(=O)O
InChIInChI=1S/C18H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(18(20)21)22-16(2)19/h17H,3-15H2,1-2H3,(H,20,21)
InChIKeyXYVRWOFSMCJEII-UHFFFAOYSA-N
MW314.47 g/mol
LogP5.09
Rot. Bonds15

About 2-acetyloxyhexadecanoic acid

2-acetyloxyhexadecanoic acid (PubChem CID 15599534) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-acetyloxyhexadecanoic acid.

Molecular Properties

Compound Name2-acetyloxyhexadecanoic acid
PubChem CID15599534
Molecular FormulaC18H34O4
Molecular Weight314.47 g/mol
Exact Mass314.25
IUPAC Name2-acetyloxyhexadecanoic acid
SMILESCCCCCCCCCCCCCCC(OC(C)=O)C(=O)O
InChIInChI=1S/C18H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(18(20)21)22-16(2)19/h17H,3-15H2,1-2H3,(H,20,21)
InChIKeyXYVRWOFSMCJEII-UHFFFAOYSA-N
XLogP5.09
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds15
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500314.47
LogP ≤ 55.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-acetyloxyhexadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxyhexadecanoic acid?
The IUPAC name of 2-acetyloxyhexadecanoic acid (CID 15599534) is 2-acetyloxyhexadecanoic acid.
What is the SMILES notation for 2-acetyloxyhexadecanoic acid?
The canonical SMILES for 2-acetyloxyhexadecanoic acid is CCCCCCCCCCCCCCC(OC(C)=O)C(=O)O.
What is the InChIKey of 2-acetyloxyhexadecanoic acid?
The InChIKey is XYVRWOFSMCJEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(18(20)21)22-16(2)19/h17H,3-15H2,1-2H3,(H,20,21).
What are the key properties of 2-acetyloxyhexadecanoic acid?
2-acetyloxyhexadecanoic acid has a molecular weight of 314.47 g/mol, XLogP of 5.09, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyhexadecanoic acid is sourced from PubChem (CID 15599534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).