C29H41N3O5 — CID 155995485
2-(2-methylpropanoyl)-N-[(3,4,5-trimethoxyphenyl)methyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxamide (PubChem CID 155995485) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-(2-methylpropanoyl)-N-[(3,4,5-trimethoxyphenyl)methyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxamide.
| Compound Name | 2-(2-methylpropanoyl)-N-[(3,4,5-trimethoxyphenyl)methyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxamide |
|---|---|
| PubChem CID | 155995485 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 2-(2-methylpropanoyl)-N-[(3,4,5-trimethoxyphenyl)methyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxamide |
| SMILES | COc1cc(CNC(=O)c2ccc3c(c2)CNCCCCCCCN3C(=O)C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C29H41N3O5/c1-20(2)29(34)32-14-10-8-6-7-9-13-30-19-23-17-22(11-12-24(23)32)28(33)31-18-21-15-25(35-3)27(37-5)26(16-21)36-4/h11-12,15-17,20,30H,6-10,13-14,18-19H2,1-5H3,(H,31,33) |
| InChIKey | CCWUJODFTDVGIU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |